Difference between revisions of "PWY-6599"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == * smiles: ** C(O)C1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=ZZZCUOFIHG...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6599 PWY-6599] ==
* smiles:
+
** C(O)C1(C(O)=C(O)C(=O)O1)
+
* inchi key:
+
** InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N
+
 
* common name:
 
* common name:
** dehydro-D-arabinono-1,4-lactone
+
** guanine and guanosine salvage II
* molecular weight:
+
* taxonomic range:
** 146.099   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one
 
** D-erythro-ascorbic acid
 
** D-erythro-ascorbate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
* [[1.1.3.37-RXN]]
+
* [[GUANPRIBOSYLTRAN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[CHC_T00004960001_1]]
 +
*** [[CHC_T00004428001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-366 RXN0-366]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=guanine and guanosine salvage II}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675775 54675775]
+
{{#set: taxonomic range=TAX-2759}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17803 17803]
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C06316 C06316]
+
{{#set: completion rate=50.0}}
{{#set: smiles=C(O)C1(C(O)=C(O)C(=O)O1)}}
+
{{#set: inchi key=InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N}}
+
{{#set: common name=dehydro-D-arabinono-1,4-lactone}}
+
{{#set: molecular weight=146.099    }}
+
{{#set: common name=(5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one|D-erythro-ascorbic acid|D-erythro-ascorbate}}
+
{{#set: produced by=1.1.3.37-RXN}}
+

Latest revision as of 16:00, 9 January 2019

Pathway PWY-6599

  • common name:
    • guanine and guanosine salvage II
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links