Difference between revisions of "PWY-7411"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18780 CPD-18780] == * smiles: ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) * inchi key: ** InChIKey=JC...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7411 PWY-7411] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** phosphatidate biosynthesis (yeast) |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''3''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[1.1.1.8-RXN]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| + | *** [[CHC_T00009494001_1]] | ||
| + | *** [[CHC_T00008461001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[RXN-15043]] | ||
| + | ** 7 associated gene(s): | ||
| + | *** [[CHC_T00008526001]] | ||
| + | *** [[CHC_T00009195001]] | ||
| + | *** [[CHC_T00009396001]] | ||
| + | *** [[CHC_T00008325001]] | ||
| + | *** [[CHC_T00008713001_1]] | ||
| + | *** [[CHC_T00008713001]] | ||
| + | *** [[CHC_T00009396001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[RXN-15045]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[CHC_T00008773001]] | ||
| + | *** [[CHC_T00008773001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15044 RXN-15044] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15046 RXN-15046] | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: common name=phosphatidate biosynthesis (yeast)}} |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2759}} |
| − | {{#set: | + | {{#set: reaction found=3}} |
| − | {{#set: | + | {{#set: total reaction=5}} |
| − | + | {{#set: completion rate=60.0}} | |
| − | {{#set: | + | |
Latest revision as of 16:01, 9 January 2019
Pathway PWY-7411
- common name:
- phosphatidate biosynthesis (yeast)
- taxonomic range:
- Synonym(s):
Reaction(s) found
3 reactions found over 5 reactions in the full pathway
- 1.1.1.8-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-15043
- 7 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-15045
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
