Difference between revisions of "B-Keto-cis-D5-dodecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=b-Keto-cis-D5-dodecenoyl-ACPs b-Keto-cis-D5-dodecenoyl-ACPs] == * common name: ** a (5Z)-3-oxo-...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=b-Keto-cis-D5-dodecenoyl-ACPs b-Keto-cis-D5-dodecenoyl-ACPs] ==
−
* smiles:
+
−
** C1(C(C(C(C(C1O)O)=O)O)O)O
+
−
* inchi key:
+
−
** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
+
 
* common name:
 
* common name:
−
** scyllo-inosose
+
** a (5Z)-3-oxo-dodec-5-enoyl-[acp]
−
* molecular weight:
+
−
** 178.141   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-keto-myo-inositol
+
** a β-keto-cis-Δ5-dodecenoyl-[acp]
−
** 2,4,6/3,5-pentahydroxycyclohexanone
+
** a 3-oxo-cis-Δ5-dodecenoyl-[acp]
−
** 2-inosose
+
−
** 2-keto-scyllo-inositol
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-2142]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-2141]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a (5Z)-3-oxo-dodec-5-enoyl-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294]
+
{{#set: common name=a β-keto-cis-Δ5-dodecenoyl-[acp]|a 3-oxo-cis-Δ5-dodecenoyl-[acp]}}
−
* CHEBI:
+
{{#set: consumed by=RXN0-2142}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811]
+
{{#set: produced by=RXN0-2141}}
−
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}}
+
−
{{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}}
+
−
{{#set: common name=scyllo-inosose}}
+
−
{{#set: molecular weight=178.141    }}
+
−
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}}
+
−
{{#set: consumed or produced by=MYO-INOSITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 16:34, 23 May 2018

Metabolite b-Keto-cis-D5-dodecenoyl-ACPs

  • common name:
    • a (5Z)-3-oxo-dodec-5-enoyl-[acp]
  • Synonym(s):
    • a β-keto-cis-Δ5-dodecenoyl-[acp]
    • a 3-oxo-cis-Δ5-dodecenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (5Z)-3-oxo-dodec-5-enoyl-[acp" cannot be used as a page name in this wiki.
  • "a β-keto-cis-Δ5-dodecenoyl-[acp" cannot be used as a page name in this wiki.
  • "a 3-oxo-cis-Δ5-dodecenoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=B-Keto-cis-D5-dodecenoyl-ACPs&oldid=14741"