Difference between revisions of "CHC 310"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10793 CPD-10793] == * smiles: ** [CH](=O)C(=O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=NZ...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_310 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** petD |
− | * | + | * left end position: |
− | ** | + | ** 45145 |
+ | * transcription direction: | ||
+ | ** POSITIVE | ||
+ | * right end position: | ||
+ | ** 45627 | ||
+ | * centisome position: | ||
+ | ** 25.068579 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN]] |
− | + | ** Source: [[annotation-original_genome]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-101]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=petD}} | |
− | + | {{#set: left end position=45145}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=45627}} | |
− | + | {{#set: centisome position=25.068579 }} | |
− | + | {{#set: reaction associated=PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-101}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:01, 9 January 2019
Gene CHC_310
- common name:
- petD
- left end position:
- 45145
- transcription direction:
- POSITIVE
- right end position:
- 45627
- centisome position:
- 25.068579
- Synonym(s):
Reactions associated
- Reaction: PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome