Difference between revisions of "CHC T00008935001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
+
== Gene CHC_T00008935001 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** 547971
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
+
** 549989
−
* molecular weight:
+
* centisome position:
−
** 442.724    
+
** 98.22399    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-13]]
+
* Reaction: [[ACYL-COA-OXIDASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
−
* [[RXN66-12]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-10696]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-10706]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-10707]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-11026]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-12518]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-12669]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14576]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14771]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14775]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14785]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14789]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14796]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16134]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-17113]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7340]]
 +
* [[PWY-7291]]
 +
* [[PWY-7606]]
 +
* [[PWY-7288]]
 +
* [[PWY-5136]]
 +
* [[PWY-7726]]
 +
* [[PWY66-391]]
 +
* [[PWY-735]]
 +
* [[PWY-7007]]
 +
* [[PWY-6837]]
 +
* [[PWY-7337]]
 +
* [[PWY-7338]]
 +
* [[PWY-6920]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=547971}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698824 15698824]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=549989}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87060 87060]
+
{{#set: centisome position=98.22399   }}
−
* HMDB : HMDB12159
+
{{#set: reaction associated=ACYL-COA-OXIDASE-RXN|RXN-10696|RXN-10706|RXN-10707|RXN-11026|RXN-12518|RXN-12669|RXN-14576|RXN-14771|RXN-14775|RXN-14785|RXN-14789|RXN-14796|RXN-16134|RXN-17113}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: pathway associated=PWY-7340|PWY-7291|PWY-7606|PWY-7288|PWY-5136|PWY-7726|PWY66-391|PWY-735|PWY-7007|PWY-6837|PWY-7337|PWY-7338|PWY-6920}}
−
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
+
−
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
+
−
{{#set: molecular weight=442.724   }}
+
−
{{#set: consumed by=RXN66-13}}
+
−
{{#set: produced by=RXN66-12}}
+

Latest revision as of 16:02, 9 January 2019

Gene CHC_T00008935001

  • left end position:
    • 547971
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 549989
  • centisome position:
    • 98.22399
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008935001&oldid=21163"