Difference between revisions of "CPD-8613"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-462 RXN1F-462] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-462 RXN1F-462] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.4.1.91 EC-2.4.1.91]
+
** 443.688   
 +
* inchi key:
 +
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
 +
* common name:
 +
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-18]]
−
** 1 [[CPD-520]][c] '''+''' 1 [[CPD-12575]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c] '''+''' 1 [[CPD1F-437]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-17]]
−
** 1 quercetin[c] '''+''' 1 UDP-α-D-glucose[c] '''=>''' 1 H+[c] '''+''' 1 UDP[c] '''+''' 1 quercetin-3-glucoside[c]
+
* [[RXN-13711]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00003244001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00001656001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00000989001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-7172]]: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7172 PWY-7172]
+
−
** '''1''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7173]], quercetin triglucoside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7173 PWY-7173]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-5390]], rutin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5390 PWY-5390]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-5321]], quercetin glycoside biosynthesis (Arabidopsis): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5321 PWY-5321]
+
−
** '''1''' reactions found over '''12''' reactions in the full pathway
+
−
* [[PWY-7129]], quercetin glucoside biosynthesis (Allium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7129 PWY-7129]
+
−
** '''1''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7137]], quercetin gentiotetraside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7137 PWY-7137]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02158 R02158]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87047 87047]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.4.1.91}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826592 91826592]
−
{{#set: gene associated=CHC_T00003244001_1|CHC_T00001656001_1|CHC_T00000989001_1}}
+
* HMDB : HMDB12165
−
{{#set: in pathway=PWY-7172|PWY-7173|PWY-5390|PWY-5321|PWY-7129|PWY-7137}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=443.688    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}}
−
{{#set: reconstruction source=a.taliana}}
+
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: consumed by=RXN66-18}}
 +
{{#set: produced by=RXN66-17|RXN-13711}}

Latest revision as of 16:15, 9 January 2019

Metabolite CPD-8613

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
  • molecular weight:
    • 443.688
  • inchi key:
    • InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
  • common name:
    • 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-8613&oldid=21472"