Difference between revisions of "PYRIDNUCSAL-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18777 CPD-18777] == * smiles: ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1) * common name: ** my...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PYRIDNUCSAL-PWY PYRIDNUCSAL-PWY] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** NAD salvage pathway I |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | * | + | |
* Synonym(s): | * Synonym(s): | ||
| + | ** pyridine nucleotide cycling | ||
| + | ** PNC VI pathway | ||
| + | ** nicotinamide adenine dinucleotide salvage | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''4''' reactions found over '''6''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[NAD-SYNTH-GLN-RXN]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| − | * [ | + | *** [[CHC_T00008954001]] |
| + | *** [[CHC_T00008954001_1]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[NADPYROPHOSPHAT-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00000276001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | * [[NICOTINAMID-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00004131001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | * [[NICOTINATEPRIBOSYLTRANS-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00004416001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=NICONUCADENYLYLTRAN-RXN NICONUCADENYLYLTRAN-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=NMNNUCLEOSID-RXN NMNNUCLEOSID-RXN] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * ECOCYC: |
| − | {{#set: | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PYRIDNUCSAL-PWY PYRIDNUCSAL-PWY] |
| − | {{#set: | + | {{#set: common name=NAD salvage pathway I}} |
| − | {{#set: | + | {{#set: taxonomic range=TAX-4751}} |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
| − | {{#set: | + | {{#set: common name=pyridine nucleotide cycling|PNC VI pathway|nicotinamide adenine dinucleotide salvage}} |
| + | {{#set: reaction found=4}} | ||
| + | {{#set: total reaction=6}} | ||
| + | {{#set: completion rate=67.0}} | ||
Latest revision as of 16:09, 9 January 2019
Pathway PYRIDNUCSAL-PWY
- common name:
- NAD salvage pathway I
- taxonomic range:
- Synonym(s):
- pyridine nucleotide cycling
- PNC VI pathway
- nicotinamide adenine dinucleotide salvage
Reaction(s) found
4 reactions found over 6 reactions in the full pathway
- NAD-SYNTH-GLN-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- NADPYROPHOSPHAT-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- NICOTINAMID-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- NICOTINATEPRIBOSYLTRANS-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
