Difference between revisions of "PYRIDNUCSAL-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18777 CPD-18777] == * smiles: ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1) * common name: ** my...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18777 CPD-18777] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PYRIDNUCSAL-PWY PYRIDNUCSAL-PWY] ==
* smiles:
+
** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)
+
 
* common name:
 
* common name:
** mycosporine glycine
+
** NAD salvage pathway I
* inchi key:
+
* taxonomic range:
** InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* molecular weight:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** 244.224   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** pyridine nucleotide cycling
 +
** PNC VI pathway
 +
** nicotinamide adenine dinucleotide salvage
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''6''' reactions in the full pathway
* [[RXN-17368]]
+
* [[NAD-SYNTH-GLN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
* [[RXN-17371]]
+
*** [[CHC_T00008954001]]
 +
*** [[CHC_T00008954001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[NADPYROPHOSPHAT-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00000276001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[NICOTINAMID-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00004131001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00004416001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=NICONUCADENYLYLTRAN-RXN NICONUCADENYLYLTRAN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=NMNNUCLEOSID-RXN NMNNUCLEOSID-RXN]
 
== External links  ==
 
== External links  ==
{{#set: smiles=COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)}}
+
* ECOCYC:
{{#set: common name=mycosporine glycine}}
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PYRIDNUCSAL-PWY PYRIDNUCSAL-PWY]
{{#set: inchi key=InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M}}
+
{{#set: common name=NAD salvage pathway I}}
{{#set: molecular weight=244.224    }}
+
{{#set: taxonomic range=TAX-4751}}
{{#set: produced by=RXN-17368}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: consumed or produced by=RXN-17371}}
+
{{#set: common name=pyridine nucleotide cycling|PNC VI pathway|nicotinamide adenine dinucleotide salvage}}
 +
{{#set: reaction found=4}}
 +
{{#set: total reaction=6}}
 +
{{#set: completion rate=67.0}}

Latest revision as of 16:09, 9 January 2019

Pathway PYRIDNUCSAL-PWY

  • common name:
    • NAD salvage pathway I
  • taxonomic range:
  • Synonym(s):
    • pyridine nucleotide cycling
    • PNC VI pathway
    • nicotinamide adenine dinucleotide salvage

Reaction(s) found

4 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links