Difference between revisions of "CPD-12118"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12118 CPD-12118] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C |
| − | * | + | * molecular weight: |
| − | ** | + | ** 773.236 |
| − | ** | + | * inchi key: |
| + | ** InChIKey=WJUVWMHFGHNQJZ-RNFPTGGASA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** demethylmenaquinol-9 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** DMKH2-9 |
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-9205]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84542 84542] | |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479709 45479709] |
| − | {{#set: | + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C}} |
| − | {{#set: common name= | + | {{#set: molecular weight=773.236 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=WJUVWMHFGHNQJZ-RNFPTGGASA-N}} |
| − | {{#set: | + | {{#set: common name=demethylmenaquinol-9}} |
| + | {{#set: common name=DMKH2-9}} | ||
| + | {{#set: consumed by=RXN-9205}} | ||
Latest revision as of 16:20, 9 January 2019
Contents
Metabolite CPD-12118
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C
- molecular weight:
- 773.236
- inchi key:
- InChIKey=WJUVWMHFGHNQJZ-RNFPTGGASA-N
- common name:
- demethylmenaquinol-9
- Synonym(s):
- DMKH2-9
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
