Difference between revisions of "CHC T00009299001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...") |
(Created page with "Category:Gene == Gene CHC_T00009299001 == * left end position: ** 95647 * transcription direction: ** NEGATIVE * right end position: ** 96918 * centisome position: ** 40.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009299001 == |
− | * | + | * left end position: |
− | ** | + | ** 95647 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 96918 |
− | * | + | * centisome position: |
− | ** | + | ** 40.43604 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-original_genome]] | |
− | * | + | *** Assignment: automated-name-match |
− | + | == Pathways associated == | |
− | * [[ | + | |
− | * | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=95647}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=96918}} | |
− | + | {{#set: centisome position=40.43604 }} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 15:41, 23 May 2018
Gene CHC_T00009299001
- left end position:
- 95647
- transcription direction:
- NEGATIVE
- right end position:
- 96918
- centisome position:
- 40.43604
- Synonym(s):
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome