Difference between revisions of "RXN-13482"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * smiles: ** C1(NC2(C(C=1CC(=O)OC)=CC=CC=2)) * inchi key: ** InChIKey=K...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13482 RXN-13482] ==
* smiles:
+
* direction:
** C1(NC2(C(C=1CC(=O)OC)=CC=CC=2))
+
** REVERSIBLE
* inchi key:
+
* ec number:
** InChIKey=KTHADMDGDNYQRX-UHFFFAOYSA-N
+
** [http://enzyme.expasy.org/EC/2.1.3.3 EC-2.1.3.3]
* common name:
+
** methyl (indol-3-yl)acetate
+
* molecular weight:
+
** 189.213   
+
 
* Synonym(s):
 
* Synonym(s):
** IAA methyl ester
 
** methyl IAA
 
** MeIAA
 
** indole-3-acetic acid methyl ester
 
** methyl 2-(1H-indol-3-yl)acetate
 
** methyl indole-3-acetate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10711]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CARBAMOYL-P]][c] '''+''' 1 [[L-ORNITHINE]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[L-CITRULLINE]][c] '''+''' 1 [[Pi]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 carbamoyl phosphate[c] '''+''' 1 L-ornithine[c] '''<=>''' 1 H+[c] '''+''' 1 L-citrulline[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00005123001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=74706 74706]
+
{{#set: ec number=EC-2.1.3.3}}
* KNAPSACK : C00000101
+
{{#set: gene associated=CHC_T00005123001_1}}
* HMDB : HMDB29738
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C20635 C20635]
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.chemspider.com/Chemical-Structure.67279.html 67279]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72782 72782]
+
* METABOLIGHTS : MTBLC72782
+
{{#set: smiles=C1(NC2(C(C=1CC(=O)OC)=CC=CC=2))}}
+
{{#set: inchi key=InChIKey=KTHADMDGDNYQRX-UHFFFAOYSA-N}}
+
{{#set: common name=methyl (indol-3-yl)acetate}}
+
{{#set: molecular weight=189.213    }}
+
{{#set: common name=IAA methyl ester|methyl IAA|MeIAA|indole-3-acetic acid methyl ester|methyl 2-(1H-indol-3-yl)acetate|methyl indole-3-acetate}}
+
{{#set: consumed by=RXN-10711}}
+

Latest revision as of 17:16, 9 January 2019

Reaction RXN-13482

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 carbamoyl phosphate[c] + 1 L-ornithine[c] <=> 1 H+[c] + 1 L-citrulline[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links