Difference between revisions of "2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxybehenoyl-ACPs R-3-hydroxybehenoyl-ACPs] == * common name: ** a (3R)-3-hydroxybehenoy...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE] == |
+ | * smiles: | ||
+ | ** CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1) | ||
+ | * molecular weight: | ||
+ | ** 276.076 | ||
+ | * inchi key: | ||
+ | ** InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 2-C-methyl-D-erythritol-2,4-cyclodiphosphate |
* Synonym(s): | * Synonym(s): | ||
+ | ** ME-2,4cPP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-882]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-302]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58483 58483] |
+ | * BIGG : 2mecdp | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21605869 21605869] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11453 C11453] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.10241147.html 10241147] | ||
+ | {{#set: smiles=CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)}} | ||
+ | {{#set: molecular weight=276.076 }} | ||
+ | {{#set: inchi key=InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L}} | ||
+ | {{#set: common name=2-C-methyl-D-erythritol-2,4-cyclodiphosphate}} | ||
+ | {{#set: common name=ME-2,4cPP}} | ||
+ | {{#set: consumed by=RXN0-882}} | ||
+ | {{#set: produced by=RXN0-302}} |
Latest revision as of 17:22, 9 January 2019
Contents
Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE
- smiles:
- CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)
- molecular weight:
- 276.076
- inchi key:
- InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L
- common name:
- 2-C-methyl-D-erythritol-2,4-cyclodiphosphate
- Synonym(s):
- ME-2,4cPP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)" cannot be used as a page name in this wiki.