Difference between revisions of "PWY-7726"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] == * smiles: ** C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2)) * inchi key: *...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase) |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | '''4''' reactions found over '''13''' reactions in the full pathway |
− | * [[ | + | * [[RXN-17112]] |
− | == | + | ** 1 associated gene(s): |
+ | *** [[CHC_T00008879001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-17113]] | ||
+ | ** 10 associated gene(s): | ||
+ | *** [[CHC_T00008400001]] | ||
+ | *** [[CHC_T00009531001_1]] | ||
+ | *** [[CHC_T00009531001]] | ||
+ | *** [[CHC_T00008478001_1]] | ||
+ | *** [[CHC_T00008400001_1]] | ||
+ | *** [[CHC_T00009142001_1]] | ||
+ | *** [[CHC_T00008935001]] | ||
+ | *** [[CHC_T00008935001_1]] | ||
+ | *** [[CHC_T00007910001_1]] | ||
+ | *** [[CHC_T00009142001]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-17114]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[CHC_T00009110001_1]] | ||
+ | *** [[CHC_T00009190001_1]] | ||
+ | *** [[CHC_T00009349001_1]] | ||
+ | *** [[CHC_T00009422001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-17116]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00009422001_1]] | ||
+ | *** [[CHC_T00009349001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16079 RXN-16079] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16081 RXN-16081] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16112 RXN-16112] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16113 RXN-16113] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16114 RXN-16114] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17109 RXN-17109] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17110 RXN-17110] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17111 RXN-17111] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17115 RXN-17115] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=13}} | |
− | + | {{#set: completion rate=31.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 16:13, 9 January 2019
Pathway PWY-7726
- common name:
- (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)
- taxonomic range:
- Synonym(s):
Reaction(s) found
4 reactions found over 13 reactions in the full pathway
- RXN-17112
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-17113
- 10 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-17114
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-17116
- 2 associated gene(s):
- 1 reconstruction source(s) associated: