Difference between revisions of "PWY-7726"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] == * smiles: ** C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2)) * inchi key: *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726] ==
* smiles:
+
** C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2))
+
* inchi key:
+
** InChIKey=MXHRCPNRJAMMIM-SHYZEUOFSA-N
+
 
* common name:
 
* common name:
** 2'-deoxyuridine
+
** (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)
* molecular weight:
+
* taxonomic range:
** 228.204   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* Synonym(s):
 
* Synonym(s):
** deoxyuridine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''13''' reactions in the full pathway
* [[CYTIDEAM-RXN]]
+
* [[RXN-17112]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00008879001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-17113]]
 +
** 10 associated gene(s):
 +
*** [[CHC_T00008400001]]
 +
*** [[CHC_T00009531001_1]]
 +
*** [[CHC_T00009531001]]
 +
*** [[CHC_T00008478001_1]]
 +
*** [[CHC_T00008400001_1]]
 +
*** [[CHC_T00009142001_1]]
 +
*** [[CHC_T00008935001]]
 +
*** [[CHC_T00008935001_1]]
 +
*** [[CHC_T00007910001_1]]
 +
*** [[CHC_T00009142001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-17114]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00009110001_1]]
 +
*** [[CHC_T00009190001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
*** [[CHC_T00009422001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-17116]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16079 RXN-16079]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16081 RXN-16081]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16112 RXN-16112]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16113 RXN-16113]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16114 RXN-16114]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17109 RXN-17109]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17110 RXN-17110]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17111 RXN-17111]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17115 RXN-17115]
 
== External links  ==
 
== External links  ==
* CAS : 951-78-0
+
{{#set: common name=(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)}}
* METABOLIGHTS : MTBLC16450
+
{{#set: taxonomic range=TAX-2759}}
* DRUGBANK : DB02256
+
{{#set: reaction found=4}}
* PUBCHEM:
+
{{#set: total reaction=13}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13712 13712]
+
{{#set: completion rate=31.0}}
* HMDB : HMDB00012
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00526 C00526]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.13118.html 13118]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16450 16450]
+
* BIGG : duri
+
{{#set: smiles=C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2))}}
+
{{#set: inchi key=InChIKey=MXHRCPNRJAMMIM-SHYZEUOFSA-N}}
+
{{#set: common name=2'-deoxyuridine}}
+
{{#set: molecular weight=228.204    }}
+
{{#set: common name=deoxyuridine}}
+
{{#set: produced by=CYTIDEAM-RXN}}
+

Latest revision as of 16:13, 9 January 2019

Pathway PWY-7726

  • common name:
    • (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

4 reactions found over 13 reactions in the full pathway

Reaction(s) not found

External links