Difference between revisions of "6-PHOSPHOFRUCTO-2-KINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * smiles: ** C(=O)([O-])CC(NC(N)=O)C([O-])=O *...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6-PHOSPHOFRUCTO-2-KINASE-RXN 6-PHOSPHOFRUCTO-2-KINASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** 6-phosphofructo-2-kinase/fructose-2, 6-biphosphatase 4 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.105 EC-2.7.1.105] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[FRUCTOSE-6P]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[CPD-535]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 ATP[c] '''+''' 1 β-D-fructofuranose 6-phosphate[c] '''=>''' 1 H+[c] '''+''' 1 ADP[c] '''+''' 1 β-D-fructose 2,6-bisphosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00009308001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | * Gene: [[CHC_T00009308001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY66-423]], fructose 2,6-bisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-423 PWY66-423] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15653 15653] |
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P26285 P26285] |
− | * | + | ** [http://www.uniprot.org/uniprot/P25114 P25114] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q7M3I3 Q7M3I3] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P49872 P49872] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q28830 Q28830] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q91348 Q91348] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JJH5 Q9JJH5] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q16875 Q16875] |
− | * | + | ** [http://www.uniprot.org/uniprot/P07953 P07953] |
− | + | ** [http://www.uniprot.org/uniprot/P16118 P16118] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P40433 P40433] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q12471 Q12471] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P70265 P70265] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P70266 P70266] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O24559 O24559] |
+ | ** [http://www.uniprot.org/uniprot/O81398 O81398] | ||
+ | ** [http://www.uniprot.org/uniprot/O64983 O64983] | ||
+ | * LIGAND-RXN: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?R02732 R02732] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=6-phosphofructo-2-kinase/fructose-2, 6-biphosphatase 4}} | ||
+ | {{#set: ec number=EC-2.7.1.105}} | ||
+ | {{#set: gene associated=CHC_T00009308001_1|CHC_T00009308001}} | ||
+ | {{#set: in pathway=PWY66-423}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 15:19, 9 January 2019
Contents
Reaction 6-PHOSPHOFRUCTO-2-KINASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 6-phosphofructo-2-kinase/fructose-2, 6-biphosphatase 4
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 FRUCTOSE-6P[c] => 1 PROTON[c] + 1 ADP[c] + 1 CPD-535[c]
- With common name(s):
- 1 ATP[c] + 1 β-D-fructofuranose 6-phosphate[c] => 1 H+[c] + 1 ADP[c] + 1 β-D-fructose 2,6-bisphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009308001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Gene: CHC_T00009308001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
- PWY66-423, fructose 2,6-bisphosphate biosynthesis: PWY66-423
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
External links
- RHEA:
- UNIPROT:
- LIGAND-RXN: