Difference between revisions of "8-AMINO-7-OXONONANOATE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008849001_1 == * Synonym(s): == Reactions associated == * ASPARAGINE--TRNA-LIGASE-RXN ** pantograph-galdieria.sulphuraria == Path...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == |
+ | * smiles: | ||
+ | ** CC(C(CCCCCC([O-])=O)=O)[N+] | ||
+ | * molecular weight: | ||
+ | ** 187.238 | ||
+ | * inchi key: | ||
+ | ** InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** 8-amino-7-oxononanoate | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 7-keto-8-aminopelargonate | ||
+ | ** KAPA | ||
+ | ** 7-KAP | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-11484]] | |
− | == | + | * [[7KAPSYN-RXN]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
+ | * [[DAPASYN-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57532 57532] |
+ | * BIGG : 8aonn | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244029 25244029] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01092 C01092] | ||
+ | * HMDB : HMDB37790 | ||
+ | {{#set: smiles=CC(C(CCCCCC([O-])=O)=O)[N+]}} | ||
+ | {{#set: molecular weight=187.238 }} | ||
+ | {{#set: inchi key=InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=8-amino-7-oxononanoate}} | ||
+ | {{#set: common name=7-keto-8-aminopelargonate|KAPA|7-KAP}} | ||
+ | {{#set: produced by=RXN-11484|7KAPSYN-RXN}} | ||
+ | {{#set: reversible reaction associated=DAPASYN-RXN}} |
Latest revision as of 15:15, 9 January 2019
Contents
Metabolite 8-AMINO-7-OXONONANOATE
- smiles:
- CC(C(CCCCCC([O-])=O)=O)[N+]
- molecular weight:
- 187.238
- inchi key:
- InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N
- common name:
- 8-amino-7-oxononanoate
- Synonym(s):
- 7-keto-8-aminopelargonate
- KAPA
- 7-KAP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(CCCCCC([O-])=O)=O)[N+" cannot be used as a page name in this wiki.