Difference between revisions of "CHC T00008635001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * inchi key: ** InChIKey=WQZGKK...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008635001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEROXID-RXN]] | |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | * [[ | + | * Reaction: [[RXN-14240]] |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | * Reaction: [[RXN-15288]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[RXN-17352]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[RXN-8635]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7214]] | ||
+ | * [[PWY-5461]] | ||
+ | * [[PWY-5466]] | ||
+ | * [[PWY-7445]] | ||
+ | * [[PWY-6824]] | ||
+ | * [[PWY-5469]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=PEROXID-RXN|RXN-14240|RXN-15288|RXN-17352|RXN-8635}} | |
− | + | {{#set: pathway associated=PWY-7214|PWY-5461|PWY-5466|PWY-7445|PWY-6824|PWY-5469}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 17:16, 9 January 2019
Gene CHC_T00008635001_1
- Synonym(s):
Reactions associated
- Reaction: PEROXID-RXN
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-14240
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-15288
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-17352
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-8635
- Source: orthology-ectocarpus_siliculosus