Difference between revisions of "CATAL-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * inchi key: ** InChIKey=...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CATAL-RXN CATAL-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.11.1.6 EC-1.11.1.6] |
− | + | ** [http://enzyme.expasy.org/EC/1.11.1.21 EC-1.11.1.21] | |
− | + | ||
− | * | + | |
− | * | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 2 [[HYDROGEN-PEROXIDE]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 2 hydrogen peroxide[c] '''=>''' 2 H2O[c] '''+''' 1 oxygen[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[CHC_T00005477001_1]] |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | * [[ | + | * Gene: [[CHC_T00007915001_1]] |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | * [[ | + | ** Source: [[orthology-arabidopsis_thaliana]] |
− | * [[ | + | == Pathways == |
− | * [[ | + | * [[DETOX1-PWY]], superoxide radicals degradation: [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY] |
− | * [[ | + | ** '''2''' reactions found over '''2''' reactions in the full pathway |
+ | * [[PWY-5506]], methanol oxidation to formaldehyde IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5506 PWY-5506] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[DETOX1-PWY-1]], reactive oxygen species degradation: [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY-1 DETOX1-PWY-1] | ||
+ | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20309 20309] |
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P11934 P11934] |
− | * | + | ** [http://www.uniprot.org/uniprot/P24270 P24270] |
− | * | + | ** [http://www.uniprot.org/uniprot/P21179 P21179] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P24168 P24168] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q7M184 Q7M184] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P0A327 P0A327] |
− | * | + | ** [http://www.uniprot.org/uniprot/P45737 P45737] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P42321 P42321] |
− | * | + | ** [http://www.uniprot.org/uniprot/O28050 O28050] |
− | + | ** [http://www.uniprot.org/uniprot/Q59337 Q59337] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P77872 P77872] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00432 P00432] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P15202 P15202] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P06115 P06115] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P07820 P07820] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P17750 P17750] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P13029 P13029] |
+ | ** [http://www.uniprot.org/uniprot/P17336 P17336] | ||
+ | ** [http://www.uniprot.org/uniprot/P04040 P04040] | ||
+ | ** [http://www.uniprot.org/uniprot/P25890 P25890] | ||
+ | ** [http://www.uniprot.org/uniprot/P04762 P04762] | ||
+ | ** [http://www.uniprot.org/uniprot/P29756 P29756] | ||
+ | ** [http://www.uniprot.org/uniprot/P44390 P44390] | ||
+ | ** [http://www.uniprot.org/uniprot/P42234 P42234] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JRF5 Q9JRF5] | ||
+ | ** [http://www.uniprot.org/uniprot/P94377 P94377] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZKX5 Q9ZKX5] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59296 Q59296] | ||
+ | ** [http://www.uniprot.org/uniprot/P55306 P55306] | ||
+ | ** [http://www.uniprot.org/uniprot/P26901 P26901] | ||
+ | ** [http://www.uniprot.org/uniprot/P14412 P14412] | ||
+ | ** [http://www.uniprot.org/uniprot/P07145 P07145] | ||
+ | ** [http://www.uniprot.org/uniprot/P17598 P17598] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41136 Q41136] | ||
+ | ** [http://www.uniprot.org/uniprot/P30567 P30567] | ||
+ | ** [http://www.uniprot.org/uniprot/P30263 P30263] | ||
+ | ** [http://www.uniprot.org/uniprot/P29422 P29422] | ||
+ | ** [http://www.uniprot.org/uniprot/P30266 P30266] | ||
+ | ** [http://www.uniprot.org/uniprot/P37743 P37743] | ||
+ | ** [http://www.uniprot.org/uniprot/P33569 P33569] | ||
+ | ** [http://www.uniprot.org/uniprot/P18123 P18123] | ||
+ | ** [http://www.uniprot.org/uniprot/P55303 P55303] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01297 Q01297] | ||
+ | ** [http://www.uniprot.org/uniprot/P49318 P49318] | ||
+ | ** [http://www.uniprot.org/uniprot/P18122 P18122] | ||
+ | ** [http://www.uniprot.org/uniprot/P49315 P49315] | ||
+ | ** [http://www.uniprot.org/uniprot/Q27710 Q27710] | ||
+ | ** [http://www.uniprot.org/uniprot/P45739 P45739] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A323 P0A323] | ||
+ | ** [http://www.uniprot.org/uniprot/P55307 P55307] | ||
+ | ** [http://www.uniprot.org/uniprot/P55308 P55308] | ||
+ | ** [http://www.uniprot.org/uniprot/P55305 P55305] | ||
+ | ** [http://www.uniprot.org/uniprot/P50979 P50979] | ||
+ | ** [http://www.uniprot.org/uniprot/Q55110 Q55110] | ||
+ | ** [http://www.uniprot.org/uniprot/P12365 P12365] | ||
+ | ** [http://www.uniprot.org/uniprot/P73911 P73911] | ||
+ | ** [http://www.uniprot.org/uniprot/P77038 P77038] | ||
+ | ** [http://www.uniprot.org/uniprot/P25819 P25819] | ||
+ | ** [http://www.uniprot.org/uniprot/O48562 O48562] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43206 Q43206] | ||
+ | ** [http://www.uniprot.org/uniprot/O22472 O22472] | ||
+ | ** [http://www.uniprot.org/uniprot/P30265 P30265] | ||
+ | ** [http://www.uniprot.org/uniprot/P48351 P48351] | ||
+ | ** [http://www.uniprot.org/uniprot/P48352 P48352] | ||
+ | ** [http://www.uniprot.org/uniprot/Q39633 Q39633] | ||
+ | ** [http://www.uniprot.org/uniprot/Q39634 Q39634] | ||
+ | ** [http://www.uniprot.org/uniprot/P32290 P32290] | ||
+ | ** [http://www.uniprot.org/uniprot/O81336 O81336] | ||
+ | ** [http://www.uniprot.org/uniprot/O81337 O81337] | ||
+ | ** [http://www.uniprot.org/uniprot/P49317 P49317] | ||
+ | ** [http://www.uniprot.org/uniprot/Q27487 Q27487] | ||
+ | ** [http://www.uniprot.org/uniprot/Q8MYL7 Q8MYL7] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9Z598 Q9Z598] | ||
+ | ** [http://www.uniprot.org/uniprot/O61235 O61235] | ||
+ | ** [http://www.uniprot.org/uniprot/O33613 O33613] | ||
+ | ** [http://www.uniprot.org/uniprot/P77948 P77948] | ||
+ | ** [http://www.uniprot.org/uniprot/O73955 O73955] | ||
+ | ** [http://www.uniprot.org/uniprot/O59651 O59651] | ||
+ | ** [http://www.uniprot.org/uniprot/O31066 O31066] | ||
+ | * LIGAND-RXN: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?R00009 R00009] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: ec number=EC-1.11.1.6}} | ||
+ | {{#set: ec number=EC-1.11.1.21}} | ||
+ | {{#set: gene associated=CHC_T00005477001_1|CHC_T00007915001_1}} | ||
+ | {{#set: in pathway=DETOX1-PWY|PWY-5506|DETOX1-PWY-1}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 16:25, 9 January 2019
Contents
Reaction CATAL-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 HYDROGEN-PEROXIDE[c] => 2 WATER[c] + 1 OXYGEN-MOLECULE[c]
- With common name(s):
- 2 hydrogen peroxide[c] => 2 H2O[c] + 1 oxygen[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00005477001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00007915001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
Pathways
- DETOX1-PWY, superoxide radicals degradation: DETOX1-PWY
- 2 reactions found over 2 reactions in the full pathway
- PWY-5506, methanol oxidation to formaldehyde IV: PWY-5506
- 1 reactions found over 2 reactions in the full pathway
- DETOX1-PWY-1, reactive oxygen species degradation: DETOX1-PWY-1
- 4 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
External links
- RHEA:
- UNIPROT:
- P11934
- P24270
- P21179
- P24168
- Q7M184
- P0A327
- P45737
- P42321
- O28050
- Q59337
- P77872
- P00432
- P15202
- P06115
- P07820
- P17750
- P13029
- P17336
- P04040
- P25890
- P04762
- P29756
- P44390
- P42234
- Q9JRF5
- P94377
- Q9ZKX5
- Q59296
- P55306
- P26901
- P14412
- P07145
- P17598
- Q41136
- P30567
- P30263
- P29422
- P30266
- P37743
- P33569
- P18123
- P55303
- Q01297
- P49318
- P18122
- P49315
- Q27710
- P45739
- P0A323
- P55307
- P55308
- P55305
- P50979
- Q55110
- P12365
- P73911
- P77038
- P25819
- O48562
- Q43206
- O22472
- P30265
- P48351
- P48352
- Q39633
- Q39634
- P32290
- O81336
- O81337
- P49317
- Q27487
- Q8MYL7
- Q9Z598
- O61235
- O33613
- P77948
- O73955
- O59651
- O31066
- LIGAND-RXN: