Difference between revisions of "CPD-8618"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00009346001_1 == * Synonym(s): == Reactions associated == * 3.4.25.1-RXN ** pantograph-galdieria.sulphuraria == Pathways associated...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00009346001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8618 CPD-8618] ==
 +
* smiles:
 +
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C
 +
* molecular weight:
 +
** 414.67   
 +
* inchi key:
 +
** InChIKey=MHYWFGFPMGLYBL-NUESBDPTSA-N
 +
* common name:
 +
** 4α-formyl-5α-cholesta-8-en-3β-ol
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.4.25.1-RXN]]
+
* [[RXN66-22]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
* [[RXN66-21]]
 +
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=3.4.25.1-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87054 87054]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263320 44263320]
 +
* HMDB : HMDB12169
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C}}
 +
{{#set: molecular weight=414.67    }}
 +
{{#set: inchi key=InChIKey=MHYWFGFPMGLYBL-NUESBDPTSA-N}}
 +
{{#set: common name=4α-formyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: consumed by=RXN66-22}}
 +
{{#set: produced by=RXN66-21}}

Latest revision as of 16:29, 9 January 2019

Metabolite CPD-8618

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C
  • molecular weight:
    • 414.67
  • inchi key:
    • InChIKey=MHYWFGFPMGLYBL-NUESBDPTSA-N
  • common name:
    • 4α-formyl-5α-cholesta-8-en-3β-ol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.