Difference between revisions of "CPD-3943"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7137 PWY-7137] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7137 PWY-7137] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* molecular weight:
 +
** 416.686   
 +
* inchi key:
 +
** InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N
 
* common name:
 
* common name:
** quercetin gentiotetraside biosynthesis
+
** (22α)-hydroxy-campesterol
 
* Synonym(s):
 
* Synonym(s):
 +
** (22S)-22-hydroxy-campesterol
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[RXN1F-462]]
+
* [[RXN-4225]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* '''3''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13798 RXN-13798]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13799 RXN-13799]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13797 RXN-13797]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-3398}}
+
* CHEBI:
{{#set: common name=quercetin gentiotetraside biosynthesis}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72331 72331]
{{#set: reaction found=1}}
+
* PUBCHEM:
{{#set: reaction not found=3}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341628 15341628]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15795 C15795]
 +
* LIPID_MAPS : LMST01031115
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.9308624.html 9308624]
 +
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: molecular weight=416.686    }}
 +
{{#set: inchi key=InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N}}
 +
{{#set: common name=(22α)-hydroxy-campesterol}}
 +
{{#set: common name=(22S)-22-hydroxy-campesterol}}
 +
{{#set: produced by=RXN-4225}}

Latest revision as of 17:32, 9 January 2019

Metabolite CPD-3943

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • molecular weight:
    • 416.686
  • inchi key:
    • InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N
  • common name:
    • (22α)-hydroxy-campesterol
  • Synonym(s):
    • (22S)-22-hydroxy-campesterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.