Difference between revisions of "PWY0-662"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O * inchi key: **...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-662 PWY0-662] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** PRPP biosynthesis I |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-phosphoribosyl 1-pyrophosphate biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''1''' reactions in the full pathway |
− | * [[ | + | * [[PRPPSYN-RXN]] |
− | + | ** 4 associated gene(s): | |
− | * [[ | + | *** [[CHC_T00007508001_1]] |
− | * [[ | + | *** [[CHC_T00008865001]] |
− | == Reaction(s) | + | *** [[CHC_T00008865001_1]] |
+ | *** [[CHC_T00008613001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-662 PWY0-662] | |
− | ** [http:// | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY0-662 PWY0-662] | |
− | + | {{#set: common name=PRPP biosynthesis I}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | * | + | {{#set: taxonomic range=TAX-2157}} |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: common name=5-phosphoribosyl 1-pyrophosphate biosynthesis}} | |
− | {{#set: | + | {{#set: reaction found=1}} |
− | {{#set: | + | {{#set: total reaction=1}} |
− | {{#set: | + | {{#set: completion rate=100.0}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:23, 9 January 2019
Pathway PWY0-662
- common name:
- PRPP biosynthesis I
- taxonomic range:
- Synonym(s):
- 5-phosphoribosyl 1-pyrophosphate biosynthesis
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- PRPPSYN-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
Reaction(s) not found
External links