Difference between revisions of "CPD-782"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEME_O HEME_O] == * common name: ** heme o * Synonym(s): == Reaction(s) known to consume the c...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-782 CPD-782] == |
+ | * smiles: | ||
+ | ** C([O-])(=O)CC1(C=CC(=C(C=1)O)O) | ||
+ | * molecular weight: | ||
+ | ** 167.141 | ||
+ | * inchi key: | ||
+ | ** InChIKey=CFFZDZCDUFSOFZ-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 3,4-dihydroxyphenylacetate |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3,4-dihydroxyphenylacetic acid | ||
+ | ** homoprotocatechuate | ||
+ | ** dihydroxyphenylacetic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN6666-5]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC17612 |
− | {{#set: | + | * CAS : 102-32-9 |
+ | * HMDB : HMDB01336 | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573910.html 4573910] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17612 17612] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01161 C01161] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460350 5460350] | ||
+ | {{#set: smiles=C([O-])(=O)CC1(C=CC(=C(C=1)O)O)}} | ||
+ | {{#set: molecular weight=167.141 }} | ||
+ | {{#set: inchi key=InChIKey=CFFZDZCDUFSOFZ-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=3,4-dihydroxyphenylacetate}} | ||
+ | {{#set: common name=3,4-dihydroxyphenylacetic acid|homoprotocatechuate|dihydroxyphenylacetic acid}} | ||
+ | {{#set: produced by=RXN6666-5}} |
Latest revision as of 15:57, 9 January 2019
Contents
Metabolite CPD-782
- smiles:
- C([O-])(=O)CC1(C=CC(=C(C=1)O)O)
- molecular weight:
- 167.141
- inchi key:
- InChIKey=CFFZDZCDUFSOFZ-UHFFFAOYSA-M
- common name:
- 3,4-dihydroxyphenylacetate
- Synonym(s):
- 3,4-dihydroxyphenylacetic acid
- homoprotocatechuate
- dihydroxyphenylacetic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC17612
- CAS : 102-32-9
- HMDB : HMDB01336
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C([O-])(=O)CC1(C=CC(=C(C=1)O)O)" cannot be used as a page name in this wiki.