Difference between revisions of "PWY-7675"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4 CPD-4] == * smiles: ** C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4 CPD-4] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7675 PWY-7675] ==
* smiles:
+
** C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))
+
* inchi key:
+
** InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K
+
 
* common name:
 
* common name:
** molybdopterin
+
** Kdo transfer to lipid IVA II
* molecular weight:
+
* taxonomic range:
** 392.321   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** MPT
 
** pyranopterin-dithiolate
 
** ene-dithiol pyranopterin
 
** H2Dtpp-mP
 
** [(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-8344]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[KDOTRANS-RXN]]
* [[RXN-8342]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00003262001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11328 RXN-11328]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Kdo transfer to lipid IVA II}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266731 45266731]
+
{{#set: taxonomic range=TAX-2}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58698 58698]
+
{{#set: total reaction=2}}
* LIGAND-CPD:
+
{{#set: completion rate=50.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C05924 C05924]
+
* HMDB : HMDB02206
+
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))}}
+
{{#set: inchi key=InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K}}
+
{{#set: common name=molybdopterin}}
+
{{#set: molecular weight=392.321    }}
+
{{#set: common name=MPT|pyranopterin-dithiolate|ene-dithiol pyranopterin|H2Dtpp-mP|[(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate}}
+
{{#set: consumed by=RXN-8344}}
+
{{#set: produced by=RXN-8342}}
+

Latest revision as of 16:24, 9 January 2019

Pathway PWY-7675

  • common name:
    • Kdo transfer to lipid IVA II
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links