Difference between revisions of "CHC T00009287001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN GLN] == * smiles: ** C(=O)(N)CCC([N+])C([O-])=O * inchi key: ** InChIKey=ZDXPYRJPNDTMRX-VKH...") |
(Created page with "Category:Gene == Gene CHC_T00009287001_1 == * Synonym(s): == Reactions associated == * Reaction: GSHTRAN-RXN ** Source: orthology-galdieria.sulphuraria ** Source:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009287001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GSHTRAN-RXN]] |
− | * | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | * [[ | + | ** Source: [[orthology-arabidopsis_thaliana]] |
− | * [[ | + | * Reaction: [[GST-RXN]] |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | * [[ | + | * Reaction: [[RXN-13673]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | * [[ | + | * Reaction: [[RXN-15680]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY-7112]] |
− | + | * [[PWY-6842]] | |
− | + | * [[PWY-4061]] | |
− | * [[ | + | * [[PWY-7533]] |
− | == | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}} | |
− | + | {{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 15:52, 23 May 2018
Gene CHC_T00009287001_1
- Synonym(s):
Reactions associated
- Reaction: GSHTRAN-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Reaction: GST-RXN
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN-13673
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN-15680
- Source: orthology-galdieria.sulphuraria