Difference between revisions of "CPD-10818"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6115 PWY-6115] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4496 TAX-44...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10818 CPD-10818] == |
− | * | + | * smiles: |
− | ** [ | + | ** C=C(CCOP(=O)([O-])[O-])C |
+ | * molecular weight: | ||
+ | ** 164.097 | ||
+ | * inchi key: | ||
+ | ** InChIKey=QMZRXYCCCYYMHF-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** isopentenyl phosphate |
* Synonym(s): | * Synonym(s): | ||
+ | ** isopentenyl-P | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10067]] | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | * [[RXN-10068]] | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65078 65078] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: reaction | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123422 44123422] |
+ | {{#set: smiles=C=C(CCOP(=O)([O-])[O-])C}} | ||
+ | {{#set: molecular weight=164.097 }} | ||
+ | {{#set: inchi key=InChIKey=QMZRXYCCCYYMHF-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=isopentenyl phosphate}} | ||
+ | {{#set: common name=isopentenyl-P}} | ||
+ | {{#set: produced by=RXN-10067}} | ||
+ | {{#set: reversible reaction associated=RXN-10068}} |
Latest revision as of 16:35, 9 January 2019
Contents
Metabolite CPD-10818
- smiles:
- C=C(CCOP(=O)([O-])[O-])C
- molecular weight:
- 164.097
- inchi key:
- InChIKey=QMZRXYCCCYYMHF-UHFFFAOYSA-L
- common name:
- isopentenyl phosphate
- Synonym(s):
- isopentenyl-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(CCOP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.