Difference between revisions of "CPD-2961"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine Protein-L-methionine] == * common name: ** a [protein]-L-methionine * Syno...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == |
+ | * smiles: | ||
+ | ** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O | ||
+ | * molecular weight: | ||
+ | ** 273.113 | ||
+ | * inchi key: | ||
+ | ** InChIKey=BIRSGZKFKXLSJQ-SQOUGZDYSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** D-gluconate 6-phosphate |
* Synonym(s): | * Synonym(s): | ||
+ | ** 6-p gluconate | ||
+ | ** 6-phospho gluconate | ||
+ | ** 6-phosphogluconic acid | ||
+ | ** 6-phospho D-gluconate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[PGLUCONDEHYDRAT-RXN]] | ||
+ | * [[RXN-9952]] | ||
+ | * [[6PGLUCONDEHYDROG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[6PGLUCONOLACT-RXN]] |
+ | * [[GLUCONOKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * METABOLIGHTS : MTBLC58759 |
− | {{#set: | + | * BIGG : 6pgc |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00345 C00345] | ||
+ | * HMDB : HMDB01316 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58759 58759] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688186 36688186] | ||
+ | {{#set: smiles=C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O}} | ||
+ | {{#set: molecular weight=273.113 }} | ||
+ | {{#set: inchi key=InChIKey=BIRSGZKFKXLSJQ-SQOUGZDYSA-K}} | ||
+ | {{#set: common name=D-gluconate 6-phosphate}} | ||
+ | {{#set: common name=6-p gluconate|6-phospho gluconate|6-phosphogluconic acid|6-phospho D-gluconate}} | ||
+ | {{#set: consumed by=PGLUCONDEHYDRAT-RXN|RXN-9952|6PGLUCONDEHYDROG-RXN}} | ||
+ | {{#set: produced by=6PGLUCONOLACT-RXN|GLUCONOKIN-RXN}} |
Latest revision as of 16:35, 9 January 2019
Contents
Metabolite CPD-2961
- smiles:
- C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O
- molecular weight:
- 273.113
- inchi key:
- InChIKey=BIRSGZKFKXLSJQ-SQOUGZDYSA-K
- common name:
- D-gluconate 6-phosphate
- Synonym(s):
- 6-p gluconate
- 6-phospho gluconate
- 6-phosphogluconic acid
- 6-phospho D-gluconate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC58759
- BIGG : 6pgc
- LIGAND-CPD:
- HMDB : HMDB01316
- CHEBI:
- PUBCHEM:
"C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O" cannot be used as a page name in this wiki.