Difference between revisions of "Protein-With-N-Terminal-Met"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7526 CPD-7526] == * smiles: ** CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-With-N-Terminal-Met Protein-With-N-Terminal-Met] == * common name: ** a peptide with an...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7526 CPD-7526] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-With-N-Terminal-Met Protein-With-N-Terminal-Met] ==
* smiles:
+
** CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
+
* inchi key:
+
** InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N
+
 
* common name:
 
* common name:
** 9,9'-di-cis-ζ-carotene
+
** a peptide with an N-terminal L-methionine
* molecular weight:
+
** 540.914   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11356]]
+
* [[3.4.11.18-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11354]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-12242-CPD-7526/PLASTOQUINONE-9//CPD-7496/CPD-12829.45.]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a peptide with an N-terminal L-methionine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6440490 6440490]
+
{{#set: consumed by=3.4.11.18-RXN}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4944750.html 4944750]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48716 48716]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15857 C15857]
+
* HMDB : HMDB03063
+
{{#set: smiles=CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N}}
+
{{#set: common name=9,9'-di-cis-ζ-carotene}}
+
{{#set: molecular weight=540.914    }}
+
{{#set: consumed by=RXN-11356}}
+
{{#set: produced by=RXN-11354}}
+
{{#set: consumed or produced by=RXN-12242-CPD-7526/PLASTOQUINONE-9//CPD-7496/CPD-12829.45.}}
+

Latest revision as of 15:53, 23 May 2018

Metabolite Protein-With-N-Terminal-Met

  • common name:
    • a peptide with an N-terminal L-methionine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links