Difference between revisions of "CHC T00000021001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...") |
(Created page with "Category:Gene == Gene CHC_T00000021001_1 == * Synonym(s): == Reactions associated == * Reaction: MALTODEXGLUCOSID-RXN ** Source: orthology-ectocarpus_siliculosus...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00000021001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[MALTODEXGLUCOSID-RXN]] | |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | * [[ | + | * Reaction: [[RXN-14281]] |
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[RXN-14282]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[RXN-14283]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[RXN-15910]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[RXN0-5183]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-842]] | ||
+ | * [[GLYCOCAT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=MALTODEXGLUCOSID-RXN|RXN-14281|RXN-14282|RXN-14283|RXN-15910|RXN0-5183}} | |
− | + | {{#set: pathway associated=PWY-842|GLYCOCAT-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 16:02, 23 May 2018
Gene CHC_T00000021001_1
- Synonym(s):
Reactions associated
- Reaction: MALTODEXGLUCOSID-RXN
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-14281
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-14282
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-14283
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-15910
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN0-5183
- Source: orthology-ectocarpus_siliculosus