Difference between revisions of "CHC T00008509001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi ke...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008509001 == |
− | * | + | * left end position: |
− | ** | + | ** 109737 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 110684 |
− | * | + | * centisome position: |
− | ** | + | ** 26.849403 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-14950]] | |
− | == | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[RXN-14957]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-14959]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN0-949]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6987]] | ||
+ | * [[PWY-7382]] | ||
+ | * [[PWY0-1275]] | ||
+ | * [[PWY0-501]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=109737}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=110684}} | |
− | + | {{#set: centisome position=26.849403 }} | |
− | + | {{#set: reaction associated=RXN-14950|RXN-14957|RXN-14959|RXN0-949}} | |
− | + | {{#set: pathway associated=PWY-6987|PWY-7382|PWY0-1275|PWY0-501}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:26, 9 January 2019
Gene CHC_T00008509001
- left end position:
- 109737
- transcription direction:
- NEGATIVE
- right end position:
- 110684
- centisome position:
- 26.849403
- Synonym(s):
Reactions associated
- Reaction: RXN-14950
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-14957
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-14959
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN0-949
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome