Difference between revisions of "PWY-5768"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * smiles: ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5768 PWY-5768] ==
* smiles:
+
** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
+
* inchi key:
+
** InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
+
 
* common name:
 
* common name:
** dihydrogeranylgeranyl diphosphate
+
** pyruvate fermentation to acetate VIII
* molecular weight:
+
* taxonomic range:
** 449.44   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* Synonym(s):
 
* Synonym(s):
** dihydroGGPP
 
** dihydrogeranylgeranyl-PP
 
** dihydrogeranylgeranyl pyrophosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN-6161]]
* [[RXN-7659]]
+
** 0 associated gene:
* [[RXN-7658]]
+
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-3962 RXN0-3962]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=pyruvate fermentation to acetate VIII}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658526 90658526]
+
{{#set: taxonomic range=TAX-4751}}
{{#set: smiles=CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K}}
+
{{#set: total reaction=2}}
{{#set: common name=dihydrogeranylgeranyl diphosphate}}
+
{{#set: completion rate=50.0}}
{{#set: molecular weight=449.44    }}
+
{{#set: common name=dihydroGGPP|dihydrogeranylgeranyl-PP|dihydrogeranylgeranyl pyrophosphate}}
+
{{#set: consumed or produced by=RXN-7659|RXN-7658}}
+

Latest revision as of 16:30, 9 January 2019

Pathway PWY-5768

  • common name:
    • pyruvate fermentation to acetate VIII
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links