Difference between revisions of "CHC T00008597001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == * smiles: ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) * inchi key: ** InChIKey=UYTPUPD...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008597001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]] | |
− | * [[RXN0- | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | == | + | * Reaction: [[RXN-7253]] |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | * [[ | + | * Reaction: [[RXN0-5408]] |
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[RXNQT-4142]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-882]] | ||
+ | * [[PWY-4702]] | ||
+ | * [[PWY-2301]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN|RXN-7253|RXN0-5408|RXNQT-4142}} | |
− | + | {{#set: pathway associated=PWY-882|PWY-4702|PWY-2301}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 16:29, 9 January 2019
Gene CHC_T00008597001_1
- Synonym(s):
Reactions associated
- Reaction: MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-7253
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN0-5408
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXNQT-4142
- Source: orthology-ectocarpus_siliculosus