Difference between revisions of "REDUCED-MENAQUINONE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008976001_1 == * Synonym(s): == Reactions associated == * 3-DEHYDROQUINATE-SYNTHASE-RXN ** pantograph-a.taliana == Pathways assoc...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=REDUCED-MENAQUINONE REDUCED-MENAQUINONE] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(=CC=CC=C1C(O)=2)) | ||
+ | * molecular weight: | ||
+ | ** 719.144 | ||
+ | * inchi key: | ||
+ | ** InChIKey=OIEZRVBFVPGODT-WQWYCSGDSA-N | ||
+ | * common name: | ||
+ | ** menaquinol-8 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** reduced menaquinone-8 | ||
+ | ** MKH2-8 | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61684 61684] |
+ | * BIGG : mql8 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479636 45479636] | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(=CC=CC=C1C(O)=2))}} | ||
+ | {{#set: molecular weight=719.144 }} | ||
+ | {{#set: inchi key=InChIKey=OIEZRVBFVPGODT-WQWYCSGDSA-N}} | ||
+ | {{#set: common name=menaquinol-8}} | ||
+ | {{#set: common name=reduced menaquinone-8|MKH2-8}} | ||
+ | {{#set: produced by=ADOMET-DMK-METHYLTRANSFER-RXN}} |
Latest revision as of 16:42, 9 January 2019
Contents
Metabolite REDUCED-MENAQUINONE
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(=CC=CC=C1C(O)=2))
- molecular weight:
- 719.144
- inchi key:
- InChIKey=OIEZRVBFVPGODT-WQWYCSGDSA-N
- common name:
- menaquinol-8
- Synonym(s):
- reduced menaquinone-8
- MKH2-8
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links