Difference between revisions of "TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42."
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * smiles: ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) * inchi key: ** InChIKey=JT...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42. TRANSENOYLCOARED-RXN-HEXANOYL-CO...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42. TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | + | ||
− | + | ||
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [ | + | ** 1.0 [[NADPH]][c] '''+''' 1.0 [[CPD0-2121]][c] '''+''' 1.0 [[PROTON]][c] '''=>''' 1.0 [[HEXANOYL-COA]][c] '''+''' 1.0 [[NADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1.0 NADPH[c] '''+''' 1.0 trans-hex-2-enoyl-CoA[c] '''+''' 1.0 H+[c] '''=>''' 1.0 hexanoyl-CoA[c] '''+''' 1.0 NADP+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[gap-filling]] | ||
+ | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | *** Tool: [[meneco]] | ||
+ | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=gap-filling}} | |
− | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | |
− | + | {{#set: reconstruction tool=meneco}} | |
− | + | {{#set: reconstruction comment=added for gapfilling}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:58, 23 May 2018
Contents
Reaction TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 NADPH[c] + 1.0 CPD0-2121[c] + 1.0 PROTON[c] => 1.0 HEXANOYL-COA[c] + 1.0 NADP[c]
- With common name(s):
- 1.0 NADPH[c] + 1.0 trans-hex-2-enoyl-CoA[c] + 1.0 H+[c] => 1.0 hexanoyl-CoA[c] + 1.0 NADP+[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium