Difference between revisions of "18-HYDROXYOLEATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NAD-KIN-RXN NAD-KIN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NAD-KIN-RXN NAD-KIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-]
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.1.23 EC-2.7.1.23]
+
** 297.457   
 +
* inchi key:
 +
** InChIKey=LQUHZVLTTWMBTO-UPHRSURJSA-M
 +
* common name:
 +
** 18-hydroxyoleate
 
* Synonym(s):
 
* Synonym(s):
 +
** 18-hydroxyoctadec-9-enoic acid
 +
** 18-hydroxy-9Z-octadecenoate
 +
** ω-hydroxy-9Z-octadecenoate
 +
** omega-hydroxy oleate
 +
** 18-hydroxy-(9Z)-oleate(1-)
 +
** ω-hydroxy-(9Z)-octadecenoate(1-)
 +
** ω-hydroxyoleate(1-)
 +
** (Z)-18-hydroxyoctadec-9-enoic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-16402]]
−
** 1 [[ATP]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 NAD+[c] '''=>''' 1 NADP+[c] '''+''' 1 H+[c] '''+''' 1 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00003138001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00004045001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-5083]], NAD/NADH phosphorylation and dephosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5083 PWY-5083]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
* [[NADPHOS-DEPHOS-PWY-1]], NAD phosphorylation and transhydrogenation: [http://metacyc.org/META/NEW-IMAGE?object=NADPHOS-DEPHOS-PWY-1 NADPHOS-DEPHOS-PWY-1]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-7268]], NAD/NADP-NADH/NADPH cytosolic interconversion (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7268 PWY-7268]
+
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7269]], NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7269 PWY-7269]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
* [[NADPHOS-DEPHOS-PWY]], NAD phosphorylation and dephosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=NADPHOS-DEPHOS-PWY NADPHOS-DEPHOS-PWY]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CHEBI:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18629 18629]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78424 78424]
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00104 R00104]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289578 86289578]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.7.1.23}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C19616 C19616]
−
{{#set: gene associated=CHC_T00003138001_1|CHC_T00004045001_1}}
+
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(=O)[O-]}}
−
{{#set: in pathway=PWY-5083|NADPHOS-DEPHOS-PWY-1|PWY-7268|PWY-7269|NADPHOS-DEPHOS-PWY}}
+
{{#set: molecular weight=297.457    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=LQUHZVLTTWMBTO-UPHRSURJSA-M}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=18-hydroxyoleate}}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: common name=18-hydroxyoctadec-9-enoic acid|18-hydroxy-9Z-octadecenoate|ω-hydroxy-9Z-octadecenoate|omega-hydroxy oleate|18-hydroxy-(9Z)-oleate(1-)|ω-hydroxy-(9Z)-octadecenoate(1-)|ω-hydroxyoleate(1-)|(Z)-18-hydroxyoctadec-9-enoic acid}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN-16402}}
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=original_genome}}
+

Latest revision as of 16:43, 9 January 2019

Metabolite 18-HYDROXYOLEATE

  • smiles:
    • C(O)CCCCCCCC=CCCCCCCCC(=O)[O-]
  • molecular weight:
    • 297.457
  • inchi key:
    • InChIKey=LQUHZVLTTWMBTO-UPHRSURJSA-M
  • common name:
    • 18-hydroxyoleate
  • Synonym(s):
    • 18-hydroxyoctadec-9-enoic acid
    • 18-hydroxy-9Z-octadecenoate
    • ω-hydroxy-9Z-octadecenoate
    • omega-hydroxy oleate
    • 18-hydroxy-(9Z)-oleate(1-)
    • ω-hydroxy-(9Z)-octadecenoate(1-)
    • ω-hydroxyoleate(1-)
    • (Z)-18-hydroxyoctadec-9-enoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)CCCCCCCC=CCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=18-HYDROXYOLEATE&oldid=22166"