Difference between revisions of "Carboxybiotin-BCCP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-ETHANOLAMINE PHOSPHORYL-ETHANOLAMINE] == * smiles: ** C(C[N+])OP([O-])([O-])=O * inc...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxybiotin-BCCP Carboxybiotin-BCCP] == * common name: ** a carboxylated-biotinylated [BCCP d...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-ETHANOLAMINE PHOSPHORYL-ETHANOLAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxybiotin-BCCP Carboxybiotin-BCCP] ==
* smiles:
+
** C(C[N+])OP([O-])([O-])=O
+
* inchi key:
+
** InChIKey=SUHOOTKUPISOBE-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** O-phosphoethanolamine
+
** a carboxylated-biotinylated [BCCP dimer]
* molecular weight:
+
** 140.055   
+
 
* Synonym(s):
 
* Synonym(s):
** phosphoryl-ethanolamine
+
** a carboxylated-biotinylated [biotin carboxyl carrier protein dimer]
** O-phosphorylethanolamine
+
** a carboxy-biotin-[BCCP]
** phosphoethanolamine
+
** ethanolamine phosphate
+
** 2-aminoethyl phosphate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.14-RXN]]
+
* [[RXN0-5055]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ETHANOLAMINE-KINASE-RXN]]
+
* [[BIOTIN-CARBOXYL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[ETHANOLAMINE-PHOSPHATE-PHOSPHO-LYASE-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 1071-23-4
+
{{#set: common name=a carboxylated-biotinylated [BCCP dimer]}}
* PUBCHEM:
+
{{#set: common name=a carboxylated-biotinylated [biotin carboxyl carrier protein dimer]|a carboxy-biotin-[BCCP]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059434 7059434]
+
{{#set: consumed by=RXN0-5055}}
* HMDB : HMDB00224
+
{{#set: produced by=BIOTIN-CARBOXYL-RXN}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00346 C00346]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.5415641.html 5415641]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58190 58190]
+
* METABOLIGHTS : MTBLC58190
+
{{#set: smiles=C(C[N+])OP([O-])([O-])=O}}
+
{{#set: inchi key=InChIKey=SUHOOTKUPISOBE-UHFFFAOYSA-M}}
+
{{#set: common name=O-phosphoethanolamine}}
+
{{#set: molecular weight=140.055    }}
+
{{#set: common name=phosphoryl-ethanolamine|O-phosphorylethanolamine|phosphoethanolamine|ethanolamine phosphate|2-aminoethyl phosphate}}
+
{{#set: consumed by=2.7.7.14-RXN}}
+
{{#set: produced by=ETHANOLAMINE-KINASE-RXN}}
+
{{#set: consumed or produced by=ETHANOLAMINE-PHOSPHATE-PHOSPHO-LYASE-RXN}}
+

Latest revision as of 15:59, 23 May 2018

Metabolite Carboxybiotin-BCCP

  • common name:
    • a carboxylated-biotinylated [BCCP dimer]
  • Synonym(s):
    • a carboxylated-biotinylated [biotin carboxyl carrier protein dimer]
    • a carboxy-biotin-[BCCP]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a carboxylated-biotinylated [BCCP dimer" cannot be used as a page name in this wiki.
  • "a carboxylated-biotinylated [biotin carboxyl carrier protein dimer" cannot be used as a page name in this wiki.
  • "a carboxy-biotin-[BCCP" cannot be used as a page name in this wiki.