Difference between revisions of "PWY-7117"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117] ==
−
* smiles:
+
−
** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])
+
−
* inchi key:
+
−
** InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 9-mercaptodethiobiotin
+
** C4 photosynthetic carbon assimilation cycle, PEPCK type
−
* molecular weight:
+
* taxonomic range:
−
** 245.316   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4479 TAX-4479]
 
* Synonym(s):
 
* Synonym(s):
−
** 9-mercaptodesthiobiotin
+
** C4 photosynthesis, PEPCK type
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-17473]]
+
'''7''' reactions found over '''10''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[ASPAMINOTRANS-RXN]]
−
* [[RXN-17472]]
+
** 8 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00010017001]]
 +
*** [[CHC_T00005085001_1]]
 +
*** [[CHC_T00008432001]]
 +
*** [[CHC_T00006498001_1]]
 +
*** [[CHC_T00009477001]]
 +
*** [[CHC_T00003344001_1]]
 +
*** [[CHC_T00009477001_1]]
 +
*** [[CHC_T00010197001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008878001]]
 +
*** [[CHC_T00009563001]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
* [[MALIC-NADP-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008878001_1]]
 +
*** [[CHC_T00009563001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PEPCARBOX-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008437001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008789001_1]]
 +
*** [[CHC_T00008992001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-13697]]
 +
** 8 associated gene(s):
 +
*** [[CHC_T00006498001_1]]
 +
*** [[CHC_T00003344001_1]]
 +
*** [[CHC_T00008432001]]
 +
*** [[CHC_T00010197001]]
 +
*** [[CHC_T00010017001]]
 +
*** [[CHC_T00005085001_1]]
 +
*** [[CHC_T00009477001_1]]
 +
*** [[CHC_T00009477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN0-5224]]
 +
** 6 associated gene(s):
 +
*** [[CHC_T00010321001_1]]
 +
*** [[CHC_T00010062001_1]]
 +
*** [[CHC_T00002086001_1]]
 +
*** [[CHC_T00010311001_1]]
 +
*** [[CHC_T00007098001_1]]
 +
*** [[CHC_T00010321001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-AMINOTRANSFERASE-RXN ALANINE-AMINOTRANSFERASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PEPCARBOXYKIN-RXN PEPCARBOXYKIN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13698 RXN-13698]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=C4 photosynthetic carbon assimilation cycle, PEPCK type}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244092 25244092]
+
{{#set: taxonomic range=TAX-3398}}
−
{{#set: smiles=C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])}}
+
{{#set: taxonomic range=TAX-4479}}
−
{{#set: inchi key=InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M}}
+
{{#set: common name=C4 photosynthesis, PEPCK type}}
−
{{#set: common name=9-mercaptodethiobiotin}}
+
{{#set: reaction found=7}}
−
{{#set: molecular weight=245.316    }}
+
{{#set: total reaction=10}}
−
{{#set: common name=9-mercaptodesthiobiotin}}
+
{{#set: completion rate=70.0}}
−
{{#set: consumed by=RXN-17473}}
+
−
{{#set: produced by=RXN-17472}}
+

Latest revision as of 16:36, 9 January 2019

Pathway PWY-7117

  • common name:
    • C4 photosynthetic carbon assimilation cycle, PEPCK type
  • taxonomic range:
  • Synonym(s):
    • C4 photosynthesis, PEPCK type

Reaction(s) found

7 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-7117&oldid=21981"