Difference between revisions of "PWY-5484"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * smiles: ** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3))) * inchi...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** glycolysis II (from fructose 6-phosphate) |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''11''' reactions found over '''11''' reactions in the full pathway |
− | + | * [[2PGADEHYDRAT-RXN]] | |
− | == Reaction(s) | + | ** 5 associated gene(s): |
+ | *** [[CHC_T00008696001]] | ||
+ | *** [[CHC_T00008696001_1]] | ||
+ | *** [[CHC_T00009127001_1]] | ||
+ | *** [[CHC_T00008490001]] | ||
+ | *** [[CHC_T00009127001]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[3PGAREARR-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[CHC_T00001519001_1]] | ||
+ | *** [[CHC_T00004490001_1]] | ||
+ | *** [[CHC_T00004201001_1]] | ||
+ | *** [[CHC_T00007707001_1]] | ||
+ | *** [[CHC_T00000449001_1]] | ||
+ | *** [[CHC_T00001241001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[6PFRUCTPHOS-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_T00009387001_1]] | ||
+ | *** [[CHC_T00008955001]] | ||
+ | *** [[CHC_T00007415001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[F16ALDOLASE-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008586001]] | ||
+ | *** [[CHC_T00008586001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[F16BDEPHOS-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[CHC_T00008570001_1]] | ||
+ | *** [[CHC_T00008369001_1]] | ||
+ | *** [[CHC_T00002260001_1]] | ||
+ | *** [[CHC_T00008570001]] | ||
+ | *** [[CHC_T00008537001]] | ||
+ | *** [[CHC_T00008537001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[GAPOXNPHOSPHN-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00009438001_1]] | ||
+ | *** [[CHC_T00009523001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[PEPDEPHOS-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[CHC_T00008530001]] | ||
+ | *** [[CHC_T00008652001]] | ||
+ | *** [[CHC_T00008652001_1]] | ||
+ | *** [[CHC_T00008482001_1]] | ||
+ | *** [[CHC_T00008482001]] | ||
+ | *** [[CHC_T00008530001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[PEPSYNTH-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008992001_1]] | ||
+ | *** [[CHC_T00008789001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[PHOSGLYPHOS-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_T00004105001_1]] | ||
+ | *** [[CHC_T00009179001]] | ||
+ | *** [[CHC_T00009179001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-15513]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[CHC_T00007707001_1]] | ||
+ | *** [[CHC_T00000449001_1]] | ||
+ | *** [[CHC_T00001519001_1]] | ||
+ | *** [[CHC_T00001241001_1]] | ||
+ | *** [[CHC_T00004201001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[TRIOSEPISOMERIZATION-RXN]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[CHC_T00009126001_1]] | ||
+ | *** [[CHC_T00009523001_1]] | ||
+ | *** [[CHC_T00009126001]] | ||
+ | *** [[CHC_T00009545001]] | ||
+ | *** [[CHC_T00009545001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5484 PWY-5484] | |
− | + | {{#set: common name=glycolysis II (from fructose 6-phosphate)}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2759}} |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: reaction found=11}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=100.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:36, 9 January 2019
Pathway PWY-5484
- common name:
- glycolysis II (from fructose 6-phosphate)
- taxonomic range:
- Synonym(s):
Reaction(s) found
11 reactions found over 11 reactions in the full pathway
- 2PGADEHYDRAT-RXN
- 5 associated gene(s):
- 4 reconstruction source(s) associated:
- 3PGAREARR-RXN
- 6 associated gene(s):
- 3 reconstruction source(s) associated:
- 6PFRUCTPHOS-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- F16ALDOLASE-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- F16BDEPHOS-RXN
- 6 associated gene(s):
- 4 reconstruction source(s) associated:
- GAPOXNPHOSPHN-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- PEPDEPHOS-RXN
- 6 associated gene(s):
- 4 reconstruction source(s) associated:
- PEPSYNTH-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- PHOSGLYPHOS-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-15513
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
- TRIOSEPISOMERIZATION-RXN
- 5 associated gene(s):
- 4 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: