Difference between revisions of "PWY-6855"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17375 CPD-17375] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)CO)=...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17375 CPD-17375] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6855 PWY-6855] ==
* smiles:
+
** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)CO)=O
+
* inchi key:
+
** InChIKey=RCALBBVHQNUWNO-OSFDYRCISA-N
+
 
* common name:
 
* common name:
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol
+
** chitin degradation I (archaea)
* molecular weight:
+
* taxonomic range:
** 650.978   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* Synonym(s):
 
* Synonym(s):
 +
** chitin degradation (archaea)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''7''' reactions in the full pathway
* [[RXN-16121]]
+
* [[3.2.1.14-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00004415001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINE-6-P-DEAMIN-RXN GLUCOSAMINE-6-P-DEAMIN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYLGLUCOSAMINE-DEACETYLASE-RXN N-ACETYLGLUCOSAMINE-DEACETYLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12309 RXN-12309]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12543 RXN-12543]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12544 RXN-12544]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12545 RXN-12545]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=chitin degradation I (archaea)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820474 91820474]
+
{{#set: taxonomic range=TAX-2157}}
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)CO)=O}}
+
{{#set: common name=chitin degradation (archaea)}}
{{#set: inchi key=InChIKey=RCALBBVHQNUWNO-OSFDYRCISA-N}}
+
{{#set: reaction found=1}}
{{#set: common name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol}}
+
{{#set: total reaction=7}}
{{#set: molecular weight=650.978    }}
+
{{#set: completion rate=14.000000000000002}}
{{#set: produced by=RXN-16121}}
+

Latest revision as of 15:17, 9 January 2019

Pathway PWY-6855

  • common name:
    • chitin degradation I (archaea)
  • taxonomic range:
  • Synonym(s):
    • chitin degradation (archaea)

Reaction(s) found

1 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links