Difference between revisions of "CMP-KDO"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-28 RXN66-28] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-28 RXN66-28] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP-KDO CMP-KDO] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O)
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1.72 EC-1.3.1.72]
+
** 541.361   
 +
* inchi key:
 +
** InChIKey=YWWJKULNWGRYAS-XKKDATLGSA-L
 +
* common name:
 +
** CMP-3-deoxy-β-D-manno-octulosonate
 
* Synonym(s):
 
* Synonym(s):
 +
** CMP-2-dehydro-3-deoxy-D-octonate
 +
** CMP-Kdo
 +
** CMP-β-Kdo
 +
** CMP-ketodeoxyoctonate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[KDOTRANS-RXN]]
−
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[DESMOSTEROL-CPD]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CHOLESTEROL]][c]
+
* [[KDOTRANS2-RXN]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 desmosterol[c] '''=>''' 1 NADP+[c] '''+''' 1 cholesterol[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00002789001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
+
−
** '''15''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01457 R01457]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85987 85987]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* BIGG : ckdo
−
{{#set: ec number=EC-1.3.1.72}}
+
* PUBCHEM:
−
{{#set: gene associated=CHC_T00002789001_1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825729 91825729]
−
{{#set: in pathway=PWY66-4}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04121 C04121]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O)}}
−
{{#set: reconstruction source=a.taliana}}
+
{{#set: molecular weight=541.361    }}
 +
{{#set: inchi key=InChIKey=YWWJKULNWGRYAS-XKKDATLGSA-L}}
 +
{{#set: common name=CMP-3-deoxy-β-D-manno-octulosonate}}
 +
{{#set: common name=CMP-2-dehydro-3-deoxy-D-octonate|CMP-Kdo|CMP-β-Kdo|CMP-ketodeoxyoctonate}}
 +
{{#set: consumed by=KDOTRANS-RXN|KDOTRANS2-RXN}}

Latest revision as of 16:48, 9 January 2019

Metabolite CMP-KDO

  • smiles:
    • C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O)
  • molecular weight:
    • 541.361
  • inchi key:
    • InChIKey=YWWJKULNWGRYAS-XKKDATLGSA-L
  • common name:
    • CMP-3-deoxy-β-D-manno-octulosonate
  • Synonym(s):
    • CMP-2-dehydro-3-deoxy-D-octonate
    • CMP-Kdo
    • CMP-β-Kdo
    • CMP-ketodeoxyoctonate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CMP-KDO&oldid=22298"