Difference between revisions of "CHC T00009281001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-294 CPD-294] == * smiles: ** C(=CC(=O)[O-])C(=O)CC([O-])=O * inchi key: ** InChIKey=SOXXPQL...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009281001 == |
− | * | + | * left end position: |
− | ** | + | ** 294515 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 296026 |
− | * | + | * centisome position: |
− | ** | + | ** 56.301315 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[GLUC1PURIDYLTRANS-RXN]] | |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[UTPHEXPURIDYLYLTRANS-RXN]] |
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7238]] | ||
+ | * [[PWY-6527]] | ||
+ | * [[PWY-7343]] | ||
+ | * [[PWY-7817]] | ||
+ | * [[PWY-3801]] | ||
+ | * [[PWY-3821]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=294515}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=296026}} | |
− | + | {{#set: centisome position=56.301315 }} | |
− | + | {{#set: reaction associated=GLUC1PURIDYLTRANS-RXN|UTPHEXPURIDYLYLTRANS-RXN}} | |
− | + | {{#set: pathway associated=PWY-7238|PWY-6527|PWY-7343|PWY-7817|PWY-3801|PWY-3821}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:38, 9 January 2019
Gene CHC_T00009281001
- left end position:
- 294515
- transcription direction:
- POSITIVE
- right end position:
- 296026
- centisome position:
- 56.301315
- Synonym(s):
Reactions associated
- Reaction: GLUC1PURIDYLTRANS-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: UTPHEXPURIDYLYLTRANS-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome