Difference between revisions of "CPD-5847"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E- E-] == * Synonym(s): == Reaction(s) known to consume the compound == * RXN0-5245 * RX...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5847 CPD-5847] == |
+ | * smiles: | ||
+ | ** CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(CCC(C)12)O))3))4)) | ||
+ | * molecular weight: | ||
+ | ** 430.713 | ||
+ | * inchi key: | ||
+ | ** InChIKey=DWEXIFLNCXYYAA-QQHSWTODSA-N | ||
+ | * common name: | ||
+ | ** 4β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-6271]] | |
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[1.14.13.72-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15717 15717] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459806 5459806] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04814 C04814] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573575.html 4573575] | ||
+ | {{#set: smiles=CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(CCC(C)12)O))3))4))}} | ||
+ | {{#set: molecular weight=430.713 }} | ||
+ | {{#set: inchi key=InChIKey=DWEXIFLNCXYYAA-QQHSWTODSA-N}} | ||
+ | {{#set: common name=4β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol}} | ||
+ | {{#set: common name=β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol}} | ||
+ | {{#set: consumed by=RXN-6271}} | ||
+ | {{#set: produced by=1.14.13.72-RXN}} |
Latest revision as of 16:17, 9 January 2019
Contents
Metabolite CPD-5847
- smiles:
- CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(CCC(C)12)O))3))4))
- molecular weight:
- 430.713
- inchi key:
- InChIKey=DWEXIFLNCXYYAA-QQHSWTODSA-N
- common name:
- 4β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol
- Synonym(s):
- β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(CCC(C)12)O))3))4))" cannot be used as a page name in this wiki.