Difference between revisions of "CHC T00003751001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2)) *...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00003751001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[1.11.1.12-RXN]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | * [[ | + | * Reaction: [[GLUTATHIONE-PEROXIDASE-RXN]] |
− | == | + | ** Source: [[orthology-galdieria.sulphuraria]] |
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-4081]] | ||
+ | * [[DETOX1-PWY-1]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=1.11.1.12-RXN|GLUTATHIONE-PEROXIDASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-4081|DETOX1-PWY-1}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 16:41, 9 January 2019
Gene CHC_T00003751001_1
- Synonym(s):
Reactions associated
- Reaction: 1.11.1.12-RXN
- Source: orthology-galdieria.sulphuraria
- Reaction: GLUTATHIONE-PEROXIDASE-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus