Difference between revisions of "CPD0-1699"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8847 CPD-8847] == * smiles: ** C=CC(C)=O * common name: ** but-1-en-3-one * inchi key: ** I...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1699 CPD0-1699] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2)) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 210.172 |
| + | * inchi key: | ||
| + | ** InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** 6-carboxy-5,6,7,8-tetrahydropterin | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 6-carboxytetrahydropterin |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-5507]] |
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61032 61032] |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123380 44123380] |
| − | {{#set: smiles=C= | + | {{#set: smiles=C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))}} |
| − | {{#set: | + | {{#set: molecular weight=210.172 }} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M}} |
| − | + | {{#set: common name=6-carboxy-5,6,7,8-tetrahydropterin}} | |
| − | {{#set: common name= | + | {{#set: common name=6-carboxytetrahydropterin}} |
| − | {{#set: | + | {{#set: produced by=RXN0-5507}} |
| − | {{#set: produced by= | + | |
Latest revision as of 16:52, 9 January 2019
Contents
Metabolite CPD0-1699
- smiles:
- C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))
- molecular weight:
- 210.172
- inchi key:
- InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M
- common name:
- 6-carboxy-5,6,7,8-tetrahydropterin
- Synonym(s):
- 6-carboxytetrahydropterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))" cannot be used as a page name in this wiki.
