Difference between revisions of "CHC T00009439001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...") |
(Created page with "Category:Gene == Gene CHC_T00009439001 == * left end position: ** 44909 * transcription direction: ** POSITIVE * right end position: ** 46828 * centisome position: ** 86.9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009439001 == |
− | * | + | * left end position: |
− | ** | + | ** 44909 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 46828 |
− | * | + | * centisome position: |
− | ** | + | ** 86.91672 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-original_genome]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=44909}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: right end position=46828}} |
− | {{#set: | + | {{#set: centisome position=86.91672 }} |
− | {{#set: | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:06, 23 May 2018
Gene CHC_T00009439001
- left end position:
- 44909
- transcription direction:
- POSITIVE
- right end position:
- 46828
- centisome position:
- 86.91672
- Synonym(s):
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome