Difference between revisions of "CPD-4184"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCMP-DEAMINASE-RXN DCMP-DEAMINASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enz...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4184 CPD-4184] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)CC3)))CC4)))C |
− | * | + | * molecular weight: |
− | ** | + | ** 400.687 |
+ | * inchi key: | ||
+ | ** InChIKey=SCEZIHJVTBQOLS-YIJYGBTNSA-N | ||
+ | * common name: | ||
+ | ** 4α-methyl-cholesta-8-enol | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN66-20]] | |
− | + | * [[RXN-13710]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28432 28432] |
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6452640 6452640] |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05110 C05110] | |
− | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)CC3)))CC4)))C}} | |
− | * | + | {{#set: molecular weight=400.687 }} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=SCEZIHJVTBQOLS-YIJYGBTNSA-N}} |
− | + | {{#set: common name=4α-methyl-cholesta-8-enol}} | |
− | {{#set: | + | {{#set: consumed by=RXN66-20|RXN-13710}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 16:52, 9 January 2019
Contents
Metabolite CPD-4184
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)CC3)))CC4)))C
- molecular weight:
- 400.687
- inchi key:
- InChIKey=SCEZIHJVTBQOLS-YIJYGBTNSA-N
- common name:
- 4α-methyl-cholesta-8-enol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.