Difference between revisions of "CPD0-1133"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476 RXN66-476] == * direction: ** LEFT-TO-RIGHT * common name: ** fatty aldehyde dehydrogenas...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476 RXN66-476] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))
 +
* molecular weight:
 +
** 1153.009   
 +
* inchi key:
 +
** InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N
 
* common name:
 
* common name:
−
** fatty aldehyde dehydrogenase
+
** maltoheptaose
−
** aldehyde dehydrogenase, (NAD) activity
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14283]]
−
** 1 [[Odd-Straight-Chain-234-Sat-FALD]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Odd-Straight-Chain-234-Sat-FA]][c] '''+''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c]
+
* [[RXN-14286]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 an odd numbered straight chain 2,3,4-saturated fatty aldehyde[c] '''+''' 1 NAD+[c] '''+''' 1 H2O[c] '''=>''' 1 an odd numbered straight chain 2,3,4-saturated fatty acid[c] '''+''' 1 NADH[c] '''+''' 2 H+[c]
+
* [[MALTODEG-RXN]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008341001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00008341001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY66-388]], fatty acid α-oxidation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-388 PWY66-388]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=fatty aldehyde dehydrogenase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61954 61954]
−
{{#set: common name=aldehyde dehydrogenase, (NAD) activity}}
+
* METABOLIGHTS : MTBLC61954
−
{{#set: ec number=EC-1.2.1.3}}
+
* BIGG : malthp
−
{{#set: gene associated=CHC_T00008341001_1|CHC_T00008341001}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY66-388}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13908996 13908996]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?G00689 G00689]
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=1153.009    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N}}
−
{{#set: reconstruction source=original_genome}}
+
{{#set: common name=maltoheptaose}}
 +
{{#set: consumed by=RXN-14283|RXN-14286}}
 +
{{#set: produced by=MALTODEG-RXN}}

Latest revision as of 16:53, 9 January 2019

Metabolite CPD0-1133

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))
  • molecular weight:
    • 1153.009
  • inchi key:
    • InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N
  • common name:
    • maltoheptaose
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD0-1133&oldid=22417"