Difference between revisions of "2-Oxo-carboxylates"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Oxo-carboxylates 2-Oxo-carboxylates] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 2-oxo carboxylate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-oxo acid |
| + | ** an α keto acid | ||
| + | ** a keto acid | ||
| + | ** a 2-oxo acid | ||
| + | ** a 2-ketocarboxylate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[S-2-HYDROXY-ACID-OXIDASE-RXN]] |
| + | * [[D-AMINO-ACID-OXIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 2-oxo carboxylate}} | |
| − | + | {{#set: common name=2-oxo acid|an α keto acid|a keto acid|a 2-oxo acid|a 2-ketocarboxylate}} | |
| − | + | {{#set: produced by=S-2-HYDROXY-ACID-OXIDASE-RXN|D-AMINO-ACID-OXIDASE-RXN}} | |
| − | + | {{#set: reversible reaction associated=ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:54, 9 January 2019
Contents
Metabolite 2-Oxo-carboxylates
- common name:
- a 2-oxo carboxylate
- Synonym(s):
- 2-oxo acid
- an α keto acid
- a keto acid
- a 2-oxo acid
- a 2-ketocarboxylate
