Difference between revisions of "CPD-2751"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5316 PWY-5316] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-40...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5316 PWY-5316] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-4070]
+
** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
 +
* molecular weight:
 +
** 192.217   
 +
* inchi key:
 +
** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
 
* common name:
 
* common name:
** nicotine biosynthesis
+
** 5'-hydroxycotinine
 
* Synonym(s):
 
* Synonym(s):
 +
** allohydroxycotinine
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[QUINOPRIBOTRANS-RXN]]
+
* [[RXN66-163]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* '''8''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13057 RXN-13057]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8248 RXN-8248]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13059 RXN-13059]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13058 RXN-13058]
+
** [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE-SYNTHA-RXN QUINOLINATE-SYNTHA-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8444 RXN-8444]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13060 RXN-13060]
+
** [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-OXID-RXN L-ASPARTATE-OXID-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4070}}
+
* PUBCHEM:
{{#set: common name=nicotine biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9815515 9815515]
{{#set: reaction found=1}}
+
* CHEMSPIDER:
{{#set: reaction not found=8}}
+
** [http://www.chemspider.com/Chemical-Structure.7991265.html 7991265]
 +
* HMDB : HMDB01427
 +
{{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}}
 +
{{#set: molecular weight=192.217    }}
 +
{{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}}
 +
{{#set: common name=5'-hydroxycotinine}}
 +
{{#set: common name=allohydroxycotinine}}
 +
{{#set: produced by=RXN66-163}}

Latest revision as of 17:55, 9 January 2019

Metabolite CPD-2751

  • smiles:
    • C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
  • molecular weight:
    • 192.217
  • inchi key:
    • InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
  • common name:
    • 5'-hydroxycotinine
  • Synonym(s):
    • allohydroxycotinine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links