Difference between revisions of "RXN-9626"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * inchi key: *...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9626 RXN-9626] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.2.2 EC-3.1.2.2] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[TETRADECANOYL-COA]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-7836]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CO-A]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 myristoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 myristate[c] '''+''' 1 H+[c] '''+''' 1 coenzyme A[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[gap-filling]] | ||
+ | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | *** Tool: [[meneco]] | ||
+ | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-3.1.2.2}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=gap-filling}} | |
− | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | |
− | + | {{#set: reconstruction tool=meneco}} | |
− | + | {{#set: reconstruction comment=added for gapfilling}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:53, 9 January 2019
Contents
Reaction RXN-9626
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 TETRADECANOYL-COA[c] + 1 WATER[c] => 1 CPD-7836[c] + 1 PROTON[c] + 1 CO-A[c]
- With common name(s):
- 1 myristoyl-CoA[c] + 1 H2O[c] => 1 myristate[c] + 1 H+[c] + 1 coenzyme A[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium