Difference between revisions of "PWY-5661"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * smiles: ** CC(=O)NC1(C(O)C(O)C(CO)O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5661 PWY-5661] ==
* smiles:
+
** CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)
+
* inchi key:
+
** InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L
+
 
* common name:
 
* common name:
** N-acetyl-α-D-glucosamine 1-phosphate
+
** GDP-glucose biosynthesis
* molecular weight:
+
* taxonomic range:
** 299.174   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN-16426]]
+
* [[GLUCOKIN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
+
*** [[CHC_T00001373001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PHOSPHOGLUCMUT-RXN]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008779001_1]]
 +
*** [[CHC_T00008779001]]
 +
*** [[CHC_T00003000001_1]]
 +
*** [[CHC_T00005896001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.34-RXN 2.7.7.34-RXN]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=GDP-glucose biosynthesis}}
** [http://www.genome.jp/dbget-bin/www_bget?C04256 C04256]
+
{{#set: taxonomic range=TAX-2759}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57776 57776]
+
{{#set: taxonomic range=TAX-2157}}
* BIGG : acgam1p
+
{{#set: reaction found=2}}
* PUBCHEM:
+
{{#set: total reaction=3}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243937 25243937]
+
{{#set: completion rate=67.0}}
* HMDB : HMDB01367
+
{{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)}}
+
{{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L}}
+
{{#set: common name=N-acetyl-α-D-glucosamine 1-phosphate}}
+
{{#set: molecular weight=299.174    }}
+
{{#set: produced by=RXN-16426}}
+
{{#set: consumed or produced by=PHOSACETYLGLUCOSAMINEMUT-RXN}}
+

Latest revision as of 17:47, 9 January 2019

Pathway PWY-5661

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links