Difference between revisions of "MALTOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOSE MALTOSE] ==
* smiles:
+
** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
+
 
* common name:
 
* common name:
** 3-oxododecanoyl-CoA
+
** maltose
* molecular weight:
+
** 959.791   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxolauroyl-CoA
+
** α-D-glucopyranose-(1→4)-D-glucopyranose
 +
** maltose
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[MALTODEG-RXN]]
 +
* [[RXN-14261]]
 +
* [[RXN-14354]]
 +
* [[AMYLOMALT-RXN]]
 +
* [[RXN-12193]]
 +
* [[RXN-14260]]
 +
* [[RXN-15910]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-5183]]
 +
* [[RXN-12279]]
 +
* [[3.2.1.68-RXN]]
 +
* [[RXN-12278]]
 +
* [[RXN-12384]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14274]]
+
* [[5.4.99.16-RXN]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=maltose}}
** [http://www.genome.jp/dbget-bin/www_bget?C05263 C05263]
+
{{#set: common name=α-D-glucopyranose-(1→4)-D-glucopyranose|maltose}}
* CHEBI:
+
{{#set: consumed by=MALTODEG-RXN|RXN-14261|RXN-14354|AMYLOMALT-RXN|RXN-12193|RXN-14260|RXN-15910}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62615 62615]
+
{{#set: produced by=RXN0-5183|RXN-12279|3.2.1.68-RXN|RXN-12278|RXN-12384}}
* BIGG : 3oddcoa
+
{{#set: reversible reaction associated=5.4.99.16-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173506 46173506]
+
* HMDB : HMDB03937
+
{{#set: smiles=CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J}}
+
{{#set: common name=3-oxododecanoyl-CoA}}
+
{{#set: molecular weight=959.791    }}
+
{{#set: common name=3-oxolauroyl-CoA}}
+
{{#set: consumed or produced by=RXN-14274}}
+

Latest revision as of 15:18, 9 January 2019

Metabolite MALTOSE

  • common name:
    • maltose
  • Synonym(s):
    • α-D-glucopyranose-(1→4)-D-glucopyranose
    • maltose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links