Difference between revisions of "PWY-7197"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12128 CPD-12128] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12128 CPD-12128] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7197 PWY-7197] ==
* smiles:
+
** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C
+
* inchi key:
+
** InChIKey=ZXHQKRGMWKZWGN-RYZSZPJESA-N
+
 
* common name:
 
* common name:
** menaquinol-11
+
** pyrimidine deoxyribonucleotide phosphorylation
* molecular weight:
+
* taxonomic range:
** 923.499   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* Synonym(s):
 
* Synonym(s):
** MKH2-11
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''4''' reactions in the full pathway
* [[RXN-9362]]
+
* [[DCDPKIN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[CHC_T00009258001_1]]
 +
*** [[CHC_T00009233001]]
 +
*** [[CHC_T00009258001]]
 +
*** [[CHC_T00009233001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[DTDPKIN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00009233001_1]]
 +
*** [[CHC_T00009258001_1]]
 +
*** [[CHC_T00009258001]]
 +
*** [[CHC_T00009233001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[DTMPKI-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00002059001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-7913]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00004355001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479543 45479543]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7197 PWY-7197]
* CHEBI:
+
{{#set: common name=pyrimidine deoxyribonucleotide phosphorylation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84547 84547]
+
{{#set: taxonomic range=TAX-2759}}
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=ZXHQKRGMWKZWGN-RYZSZPJESA-N}}
+
{{#set: taxonomic range=TAX-2157}}
{{#set: common name=menaquinol-11}}
+
{{#set: reaction found=4}}
{{#set: molecular weight=923.499    }}
+
{{#set: total reaction=4}}
{{#set: common name=MKH2-11}}
+
{{#set: completion rate=100.0}}
{{#set: produced by=RXN-9362}}
+

Latest revision as of 16:48, 9 January 2019

Pathway PWY-7197

  • common name:
    • pyrimidine deoxyribonucleotide phosphorylation
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links